C8H15Cl2N3O2 — CID 3019251
2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethanol;dihydrochloride (PubChem CID 3019251) has the molecular formula C8H15Cl2N3O2 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethanol;dihydrochloride.
| Compound Name | 2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 3019251 |
| Molecular Formula | C8H15Cl2N3O2 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethanol;dihydrochloride |
| SMILES | COc1ccc(N)c(NCCO)n1.Cl.Cl |
| InChI | InChI=1S/C8H13N3O2.2ClH/c1-13-7-3-2-6(9)8(11-7)10-4-5-12;;/h2-3,12H,4-5,9H2,1H3,(H,10,11);2*1H |
| InChIKey | YIPMUHVZAQNZOY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |