C7H7N3O2 — CID 83668453
6-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine (PubChem CID 83668453) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 6-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine.
| Compound Name | 6-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 83668453 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 6-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| SMILES | COc1ccc2c(N)noc2n1 |
| InChI | InChI=1S/C7H7N3O2/c1-11-5-3-2-4-6(8)10-12-7(4)9-5/h2-3H,1H3,(H2,8,10) |
| InChIKey | JBFROJLIVMFCCS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |