About methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate
methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 118867675) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate.
Analyze methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate?
The IUPAC name of methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate (CID 118867675) is methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate.
What is the SMILES notation for methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate?
The canonical SMILES for methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate is COC(=O)c1ccc2c(N)noc2n1.
What is the InChIKey of methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate?
The InChIKey is BTHMBXPJTSSBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c1-13-8(12)5-3-2-4-6(9)11-14-7(4)10-5/h2-3H,1H3,(H2,9,11).
What are the key properties of methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate?
methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate has a molecular weight of 193.16 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-[1,2]oxazolo[5,4-b]pyridine-6-carboxylate is sourced from PubChem (CID 118867675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).