C8H7F3N2O2 — CID 131465361
methyl 6-amino-5-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 131465361) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is methyl 6-amino-5-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 6-amino-5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 131465361 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | methyl 6-amino-5-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C8H7F3N2O2/c1-15-7(14)5-3-2-4(6(12)13-5)8(9,10)11/h2-3H,1H3,(H2,12,13) |
| InChIKey | KTCRGKPFUZTMBS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |