C10H11F4N3O2 — CID 114169838
methyl 5-amino-6-(2,2,3,3-tetrafluoropropylamino)pyridine-2-carboxylate (PubChem CID 114169838) has the molecular formula C10H11F4N3O2 and a molecular weight of 281.21 g/mol. Its IUPAC name is methyl 5-amino-6-(2,2,3,3-tetrafluoropropylamino)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-(2,2,3,3-tetrafluoropropylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114169838 |
| Molecular Formula | C10H11F4N3O2 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl 5-amino-6-(2,2,3,3-tetrafluoropropylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H11F4N3O2/c1-19-8(18)6-3-2-5(15)7(17-6)16-4-10(13,14)9(11)12/h2-3,9H,4,15H2,1H3,(H,16,17) |
| InChIKey | VQNKFYNAWXMUGI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|