About 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine
6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine (PubChem CID 118867635) has the molecular formula C13H11N3O2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 118867635 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| SMILES | COc1ccc(-c2ccc3c(N)noc3n2)cc1 |
| InChI | InChI=1S/C13H11N3O2/c1-17-9-4-2-8(3-5-9)11-7-6-10-12(14)16-18-13(10)15-11/h2-7H,1H3,(H2,14,16) |
| InChIKey | ARZDJXOCFVTHDI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The IUPAC name of 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine (CID 118867635) is 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine is COc1ccc(-c2ccc3c(N)noc3n2)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The InChIKey is ARZDJXOCFVTHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2/c1-17-9-4-2-8(3-5-9)11-7-6-10-12(14)16-18-13(10)15-11/h2-7H,1H3,(H2,14,16).
What are the key properties of 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine?
6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine has a molecular weight of 241.25 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 118867635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).