C11H11NO2S — CID 5325027
3-(4-methoxyphenyl)-5-methylsulfanyl-1,2-oxazole (PubChem CID 5325027) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-methylsulfanyl-1,2-oxazole.
| Compound Name | 3-(4-methoxyphenyl)-5-methylsulfanyl-1,2-oxazole |
|---|---|
| PubChem CID | 5325027 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-methylsulfanyl-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(SC)on2)cc1 |
| InChI | InChI=1S/C11H11NO2S/c1-13-9-5-3-8(4-6-9)10-7-11(15-2)14-12-10/h3-7H,1-2H3 |
| InChIKey | XSGYBQONSWWHGM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |