C19H19NO5 — CID 91309550
3-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 91309550) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 91309550 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)on2)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-21-14-7-5-12(6-8-14)15-11-16(25-20-15)13-9-17(22-2)19(24-4)18(10-13)23-3/h5-11H,1-4H3 |
| InChIKey | BXVRVBJOOIXPMT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |