C18H16N2O6 — CID 169224083
3-(3-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 169224083) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-(3-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 169224083 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-(3-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(-c2cc(-c3cccc([N+](=O)[O-])c3)no2)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N2O6/c1-23-16-8-12(9-17(24-2)18(16)25-3)15-10-14(19-26-15)11-5-4-6-13(7-11)20(21)22/h4-10H,1-3H3 |
| InChIKey | YZXSCJRNDOHBKR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 96.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|