C18H16INO4 — CID 90718317
3-(4-iodophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 90718317) has the molecular formula C18H16INO4 and a molecular weight of 437.23 g/mol. Its IUPAC name is 3-(4-iodophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 3-(4-iodophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 90718317 |
| Molecular Formula | C18H16INO4 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 3-(4-iodophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(-c2cc(-c3ccc(I)cc3)no2)cc(OC)c1OC |
| InChI | InChI=1S/C18H16INO4/c1-21-16-8-12(9-17(22-2)18(16)23-3)15-10-14(20-24-15)11-4-6-13(19)7-5-11/h4-10H,1-3H3 |
| InChIKey | WIILOTRAIDLMCY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|