C38H38N2O8S — CID 123720035
5-[3-[5-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-(214N)1,2-oxazole (PubChem CID 123720035) has the molecular formula C38H38N2O8S and a molecular weight of 682.79 g/mol. Its IUPAC name is 5-[3-[5-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-(214N)1,2-oxazole.
| Compound Name | 5-[3-[5-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-(214N)1,2-oxazole |
|---|---|
| PubChem CID | 123720035 |
| Molecular Formula | C38H38N2O8S |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | 5-[3-[5-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-(214N)1,2-oxazole |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)[14n]o2)cc1OCCCCCOc1cc(-c2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C38H38N2O8S/c1-41-29-15-13-24(31-23-28(40-48-31)26-21-34(43-3)37(45-5)35(22-26)44-4)19-32(29)46-17-9-6-10-18-47-33-20-25(14-16-30(33)42-2)38-39-27-11-7-8-12-36(27)49-38/h7-8,11-16,19-23H,6,9-10,17-18H2,1-5H3/i40+0 |
| InChIKey | YPUJXXURKSVKHG-RMQSPREASA-N |
| XLogP | 8.96 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|