C42H48N4O7S — CID 154052159
5-[3-[3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propyl]piperazin-1-yl]propoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 154052159) has the molecular formula C42H48N4O7S and a molecular weight of 752.93 g/mol. Its IUPAC name is 5-[3-[3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propyl]piperazin-1-yl]propoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-[3-[3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propyl]piperazin-1-yl]propoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 154052159 |
| Molecular Formula | C42H48N4O7S |
| Molecular Weight | 752.93 g/mol |
| Exact Mass | 752.32 |
| IUPAC Name | 5-[3-[3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propyl]piperazin-1-yl]propoxy]-4-methoxyphenyl]-3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | COc1ccc(C2CC(c3cc(OC)c(OC)c(OC)c3)=NO2)cc1OCCCN1CCN(CCCOc2ccc(-c3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C42H48N4O7S/c1-47-35-16-13-30(36-28-34(44-53-36)31-26-38(48-2)41(50-4)39(27-31)49-3)25-37(35)52-24-8-18-46-21-19-45(20-22-46)17-7-23-51-32-14-11-29(12-15-32)42-43-33-9-5-6-10-40(33)54-42/h5-6,9-16,25-27,36H,7-8,17-24,28H2,1-4H3 |
| InChIKey | OREJRWOJYOENNB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.93 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|