C47H59N3O6S — CID 154486024
2-[3-[6-[4-[6-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexyl]piperazin-1-yl]hexoxy]phenyl]-1,3-benzothiazole (PubChem CID 154486024) has the molecular formula C47H59N3O6S and a molecular weight of 794.07 g/mol. Its IUPAC name is 2-[3-[6-[4-[6-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexyl]piperazin-1-yl]hexoxy]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-[6-[4-[6-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexyl]piperazin-1-yl]hexoxy]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 154486024 |
| Molecular Formula | C47H59N3O6S |
| Molecular Weight | 794.07 g/mol |
| Exact Mass | 793.41 |
| IUPAC Name | 2-[3-[6-[4-[6-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexyl]piperazin-1-yl]hexoxy]phenyl]-1,3-benzothiazole |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OCCCCCCN1CCN(CCCCCCOc2cccc(-c3nc4ccccc4s3)c2)CC1 |
| InChI | InChI=1S/C47H59N3O6S/c1-51-41-23-22-36(20-21-37-33-43(52-2)46(54-4)44(34-37)53-3)32-42(41)56-31-14-8-6-12-25-50-28-26-49(27-29-50)24-11-5-7-13-30-55-39-17-15-16-38(35-39)47-48-40-18-9-10-19-45(40)57-47/h9-10,15-23,32-35H,5-8,11-14,24-31H2,1-4H3/b21-20- |
| InChIKey | DENSIIFMZSDPME-MRCUWXFGSA-N |
| XLogP | 10.36 |
| TPSA | 74.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.07 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|