C35H39N5O4S — CID 71112292
(6aS)-3-[3-[4-[2-[3-(1,3-benzothiazol-2-yl)phenoxy]ethyl]piperazin-1-yl]propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 71112292) has the molecular formula C35H39N5O4S and a molecular weight of 625.80 g/mol. Its IUPAC name is (6aS)-3-[3-[4-[2-[3-(1,3-benzothiazol-2-yl)phenoxy]ethyl]piperazin-1-yl]propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[3-[4-[2-[3-(1,3-benzothiazol-2-yl)phenoxy]ethyl]piperazin-1-yl]propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 71112292 |
| Molecular Formula | C35H39N5O4S |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | (6aS)-3-[3-[4-[2-[3-(1,3-benzothiazol-2-yl)phenoxy]ethyl]piperazin-1-yl]propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCCN1CCN(CCOc3cccc(-c4nc5ccccc5s4)c3)CC1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C35H39N5O4S/c1-42-31-22-28-30(36-24-26-8-5-13-40(26)35(28)41)23-32(31)44-19-6-12-38-14-16-39(17-15-38)18-20-43-27-9-4-7-25(21-27)34-37-29-10-2-3-11-33(29)45-34/h2-4,7,9-11,21-24,26H,5-6,8,12-20H2,1H3/t26-/m0/s1 |
| InChIKey | JGZZNCFLRCGKEH-SANMLTNESA-N |
| XLogP | 5.76 |
| TPSA | 79.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|