C27H23N3O4S — CID 59317657
(6aS)-3-[[4-(1,3-benzothiazol-2-yl)phenoxy]methoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 59317657) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is (6aS)-3-[[4-(1,3-benzothiazol-2-yl)phenoxy]methoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[[4-(1,3-benzothiazol-2-yl)phenoxy]methoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 59317657 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (6aS)-3-[[4-(1,3-benzothiazol-2-yl)phenoxy]methoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCOc1ccc(-c3nc4ccccc4s3)cc1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C27H23N3O4S/c1-32-23-13-20-22(28-15-18-5-4-12-30(18)27(20)31)14-24(23)34-16-33-19-10-8-17(9-11-19)26-29-21-6-2-3-7-25(21)35-26/h2-3,6-11,13-15,18H,4-5,12,16H2,1H3/t18-/m0/s1 |
| InChIKey | XXAKCWMQHLYHPA-SFHVURJKSA-N |
| XLogP | 5.71 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|