C36H30N2O5 — CID 57344374
(6aS)-2-methoxy-3-[2-[4-[(10-oxoanthracen-9-ylidene)methyl]phenoxy]ethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 57344374) has the molecular formula C36H30N2O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is (6aS)-2-methoxy-3-[2-[4-[(10-oxoanthracen-9-ylidene)methyl]phenoxy]ethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-2-methoxy-3-[2-[4-[(10-oxoanthracen-9-ylidene)methyl]phenoxy]ethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 57344374 |
| Molecular Formula | C36H30N2O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (6aS)-2-methoxy-3-[2-[4-[(10-oxoanthracen-9-ylidene)methyl]phenoxy]ethoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCOc1ccc(C=C3c4ccccc4C(=O)c4ccccc43)cc1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C36H30N2O5/c1-41-33-20-31-32(37-22-24-7-6-16-38(24)36(31)40)21-34(33)43-18-17-42-25-14-12-23(13-15-25)19-30-26-8-2-4-10-28(26)35(39)29-11-5-3-9-27(29)30/h2-5,8-15,19-22,24H,6-7,16-18H2,1H3/t24-/m0/s1 |
| InChIKey | XXTJTEPBDMWVTH-DEOSSOPVSA-N |
| XLogP | 6.61 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|