C32H35N3O3 — CID 53468432
(6aS)-3-(7-carbazol-9-ylheptoxy)-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 53468432) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is (6aS)-3-(7-carbazol-9-ylheptoxy)-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-(7-carbazol-9-ylheptoxy)-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 53468432 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (6aS)-3-(7-carbazol-9-ylheptoxy)-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCCCCCCn1c3ccccc3c3ccccc31)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C32H35N3O3/c1-37-30-20-26-27(33-22-23-12-11-18-34(23)32(26)36)21-31(30)38-19-10-4-2-3-9-17-35-28-15-7-5-13-24(28)25-14-6-8-16-29(25)35/h5-8,13-16,20-23H,2-4,9-12,17-19H2,1H3/t23-/m0/s1 |
| InChIKey | BZUTYIYYZJMZOP-QHCPKHFHSA-N |
| XLogP | 7.15 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|