C26H31N3O5 — CID 102104962
5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[(3-methoxyphenyl)methyl]pentanamide (PubChem CID 102104962) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[(3-methoxyphenyl)methyl]pentanamide.
| Compound Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[(3-methoxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 102104962 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-[(3-methoxyphenyl)methyl]pentanamide |
| SMILES | COc1cccc(CNC(=O)CCCCOc2cc3c(cc2OC)C(=O)N2CCC[C@H]2C=N3)c1 |
| InChI | InChI=1S/C26H31N3O5/c1-32-20-9-5-7-18(13-20)16-28-25(30)10-3-4-12-34-24-15-22-21(14-23(24)33-2)26(31)29-11-6-8-19(29)17-27-22/h5,7,9,13-15,17,19H,3-4,6,8,10-12,16H2,1-2H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | NARNUZBKKLNENP-IBGZPJMESA-N |
| XLogP | 3.89 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|