C29H26Cl2N2O5 — CID 24938082
3-[3-(2-benzoyl-4,6-dichlorophenoxy)propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 24938082) has the molecular formula C29H26Cl2N2O5 and a molecular weight of 553.44 g/mol. Its IUPAC name is 3-[3-(2-benzoyl-4,6-dichlorophenoxy)propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | 3-[3-(2-benzoyl-4,6-dichlorophenoxy)propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 24938082 |
| Molecular Formula | C29H26Cl2N2O5 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 3-[3-(2-benzoyl-4,6-dichlorophenoxy)propoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCCOc1c(Cl)cc(Cl)cc1C(=O)c1ccccc1)N=CC1CCCN1C2=O |
| InChI | InChI=1S/C29H26Cl2N2O5/c1-36-25-15-21-24(32-17-20-9-5-10-33(20)29(21)35)16-26(25)37-11-6-12-38-28-22(13-19(30)14-23(28)31)27(34)18-7-3-2-4-8-18/h2-4,7-8,13-17,20H,5-6,9-12H2,1H3 |
| InChIKey | CYKFRRUUBOPLHI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|