C30H34N4O6 — CID 163867078
(6aS)-3-[3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-6a-methyl-8,9-dihydro-7H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 163867078) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is (6aS)-3-[3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-6a-methyl-8,9-dihydro-7H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-6a-methyl-8,9-dihydro-7H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 163867078 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (6aS)-3-[3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-6a-methyl-8,9-dihydro-7H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCCOc1cc3c(cc1OC)C(=O)N1CCC[C@@]1(C)C=N3)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C30H34N4O6/c1-30-8-5-10-34(30)29(36)21-14-25(38-3)27(16-23(21)32-18-30)40-12-6-11-39-26-15-22-20(13-24(26)37-2)28(35)33-9-4-7-19(33)17-31-22/h13-19H,4-12H2,1-3H3/t19-,30-/m0/s1 |
| InChIKey | PHOFOIBNUUAMPS-ADSBAMQRSA-N |
| XLogP | 4.58 |
| TPSA | 102.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|