C24H34N4O3S2 — CID 87340328
3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]-4-methylpiperazine-1-carbodithioic acid (PubChem CID 87340328) has the molecular formula C24H34N4O3S2 and a molecular weight of 490.70 g/mol. Its IUPAC name is 3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]-4-methylpiperazine-1-carbodithioic acid.
| Compound Name | 3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]-4-methylpiperazine-1-carbodithioic acid |
|---|---|
| PubChem CID | 87340328 |
| Molecular Formula | C24H34N4O3S2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]-4-methylpiperazine-1-carbodithioic acid |
| SMILES | COc1cc2c(cc1OCCCCCC1CN(C(=S)S)CCN1C)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C24H34N4O3S2/c1-26-10-11-27(24(32)33)16-18(26)7-4-3-5-12-31-22-14-20-19(13-21(22)30-2)23(29)28-9-6-8-17(28)15-25-20/h13-15,17-18H,3-12,16H2,1-2H3,(H,32,33)/t17-,18?/m0/s1 |
| InChIKey | XQQUYNXTUAZBQO-ZENAZSQFSA-N |
| XLogP | 3.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|