C32H27N3O4 — CID 10436613
3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-pyren-1-ylpropanamide (PubChem CID 10436613) has the molecular formula C32H27N3O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-pyren-1-ylpropanamide.
| Compound Name | 3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-pyren-1-ylpropanamide |
|---|---|
| PubChem CID | 10436613 |
| Molecular Formula | C32H27N3O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 3-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-pyren-1-ylpropanamide |
| SMILES | COc1cc2c(cc1OCCC(=O)Nc1ccc3ccc4cccc5ccc1c3c45)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C32H27N3O4/c1-38-27-16-24-26(33-18-22-6-3-14-35(22)32(24)37)17-28(27)39-15-13-29(36)34-25-12-10-21-8-7-19-4-2-5-20-9-11-23(25)31(21)30(19)20/h2,4-5,7-12,16-18,22H,3,6,13-15H2,1H3,(H,34,36)/t22-/m0/s1 |
| InChIKey | VNDMZMMEGIBBBO-QFIPXVFZSA-N |
| XLogP | 6.32 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|