C35H33NO7S — CID 72665182
3-[3-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]-4-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 72665182) has the molecular formula C35H33NO7S and a molecular weight of 611.72 g/mol. Its IUPAC name is 3-[3-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]-4-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]-4-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 72665182 |
| Molecular Formula | C35H33NO7S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 3-[3-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]-4-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCCCOc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C35H33NO7S/c1-38-29-17-11-23(10-16-28(37)25-21-31(39-2)34(41-4)32(22-25)40-3)20-30(29)43-19-7-18-42-26-14-12-24(13-15-26)35-36-27-8-5-6-9-33(27)44-35/h5-6,8-17,20-22H,7,18-19H2,1-4H3 |
| InChIKey | FBKZUEMFFBABOZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|