C18H14N2O5 — CID 175588487
3-(7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-5-(3-nitrophenyl)-1,2-oxazole (PubChem CID 175588487) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 3-(7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-5-(3-nitrophenyl)-1,2-oxazole.
| Compound Name | 3-(7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-5-(3-nitrophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 175588487 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-(7-methoxy-2,3-dihydro-1-benzofuran-5-yl)-5-(3-nitrophenyl)-1,2-oxazole |
| SMILES | COc1cc(-c2cc(-c3cccc([N+](=O)[O-])c3)on2)cc2c1OCC2 |
| InChI | InChI=1S/C18H14N2O5/c1-23-17-9-13(7-12-5-6-24-18(12)17)15-10-16(25-19-15)11-3-2-4-14(8-11)20(21)22/h2-4,7-10H,5-6H2,1H3 |
| InChIKey | OKRNJNQNHPXIIE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|