C12H15NO4P+ — CID 57029038
hydroxy-methoxy-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-methylphosphanium (PubChem CID 57029038) has the molecular formula C12H15NO4P+ and a molecular weight of 268.23 g/mol. Its IUPAC name is hydroxy-methoxy-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-methylphosphanium.
| Compound Name | hydroxy-methoxy-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-methylphosphanium |
|---|---|
| PubChem CID | 57029038 |
| Molecular Formula | C12H15NO4P+ |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | hydroxy-methoxy-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-methylphosphanium |
| SMILES | COc1ccc(-c2cc([P+](C)(O)OC)on2)cc1 |
| InChI | InChI=1S/C12H15NO4P/c1-15-10-6-4-9(5-7-10)11-8-12(17-13-11)18(3,14)16-2/h4-8,14H,1-3H3/q+1 |
| InChIKey | BJUMJVJUKIUTGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|