C11H9N3O2 — CID 83704376
3-amino-5-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile (PubChem CID 83704376) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3-amino-5-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile.
| Compound Name | 3-amino-5-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 83704376 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-amino-5-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile |
| SMILES | COc1ccc(-c2onc(N)c2C#N)cc1 |
| InChI | InChI=1S/C11H9N3O2/c1-15-8-4-2-7(3-5-8)10-9(6-12)11(13)14-16-10/h2-5H,1H3,(H2,13,14) |
| InChIKey | SQBIIRPNLOJLRS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |