C21H13N5O2 — CID 1488060
2-amino-6-[4-(4-methoxyphenoxy)phenyl]pyridine-3,4,5-tricarbonitrile (PubChem CID 1488060) has the molecular formula C21H13N5O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-amino-6-[4-(4-methoxyphenoxy)phenyl]pyridine-3,4,5-tricarbonitrile.
| Compound Name | 2-amino-6-[4-(4-methoxyphenoxy)phenyl]pyridine-3,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 1488060 |
| Molecular Formula | C21H13N5O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-amino-6-[4-(4-methoxyphenoxy)phenyl]pyridine-3,4,5-tricarbonitrile |
| SMILES | COc1ccc(Oc2ccc(-c3nc(N)c(C#N)c(C#N)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C21H13N5O2/c1-27-14-6-8-16(9-7-14)28-15-4-2-13(3-5-15)20-18(11-23)17(10-22)19(12-24)21(25)26-20/h2-9H,1H3,(H2,25,26) |
| InChIKey | QSTYDKIQNGVXBQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |