C12H10N4O — CID 12862277
4-amino-2-methoxy-6-phenylpyrimidine-5-carbonitrile (PubChem CID 12862277) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-amino-2-methoxy-6-phenylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-methoxy-6-phenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 12862277 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-amino-2-methoxy-6-phenylpyrimidine-5-carbonitrile |
| SMILES | COc1nc(N)c(C#N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H10N4O/c1-17-12-15-10(8-5-3-2-4-6-8)9(7-13)11(14)16-12/h2-6H,1H3,(H2,14,15,16) |
| InChIKey | UFJUMNIVIHSHJR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |