C17H15N3O — CID 624065
2-methoxy-4,6-diphenylpyrimidin-5-amine (PubChem CID 624065) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-methoxy-4,6-diphenylpyrimidin-5-amine.
| Compound Name | 2-methoxy-4,6-diphenylpyrimidin-5-amine |
|---|---|
| PubChem CID | 624065 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-methoxy-4,6-diphenylpyrimidin-5-amine |
| SMILES | COc1nc(-c2ccccc2)c(N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H15N3O/c1-21-17-19-15(12-8-4-2-5-9-12)14(18)16(20-17)13-10-6-3-7-11-13/h2-11H,18H2,1H3 |
| InChIKey | GFARVRPGYFBMBU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |