C15H9N5O — CID 12736666
2-amino-6-(4-methoxyphenyl)pyridine-3,4,5-tricarbonitrile (PubChem CID 12736666) has the molecular formula C15H9N5O and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-amino-6-(4-methoxyphenyl)pyridine-3,4,5-tricarbonitrile.
| Compound Name | 2-amino-6-(4-methoxyphenyl)pyridine-3,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 12736666 |
| Molecular Formula | C15H9N5O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-amino-6-(4-methoxyphenyl)pyridine-3,4,5-tricarbonitrile |
| SMILES | COc1ccc(-c2nc(N)c(C#N)c(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C15H9N5O/c1-21-10-4-2-9(3-5-10)14-12(7-17)11(6-16)13(8-18)15(19)20-14/h2-5H,1H3,(H2,19,20) |
| InChIKey | AQIJPSZWRJVSTH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |