C20H14N4O — CID 170319410
2-amino-6-methoxy-4-(3-phenylphenyl)pyridine-3,5-dicarbonitrile (PubChem CID 170319410) has the molecular formula C20H14N4O and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-amino-6-methoxy-4-(3-phenylphenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-methoxy-4-(3-phenylphenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 170319410 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-amino-6-methoxy-4-(3-phenylphenyl)pyridine-3,5-dicarbonitrile |
| SMILES | COc1nc(N)c(C#N)c(-c2cccc(-c3ccccc3)c2)c1C#N |
| InChI | InChI=1S/C20H14N4O/c1-25-20-17(12-22)18(16(11-21)19(23)24-20)15-9-5-8-14(10-15)13-6-3-2-4-7-13/h2-10H,1H3,(H2,23,24) |
| InChIKey | AEUVJUKRNXTVQM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |