C21H16N4O2 — CID 177102078
6-amino-2-(2-hydroxyethoxy)-5-isocyano-4-(3-phenylphenyl)pyridine-3-carbonitrile (PubChem CID 177102078) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-amino-2-(2-hydroxyethoxy)-5-isocyano-4-(3-phenylphenyl)pyridine-3-carbonitrile.
| Compound Name | 6-amino-2-(2-hydroxyethoxy)-5-isocyano-4-(3-phenylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 177102078 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-amino-2-(2-hydroxyethoxy)-5-isocyano-4-(3-phenylphenyl)pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(N)nc(OCCO)c(C#N)c1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H16N4O2/c1-24-19-18(17(13-22)21(25-20(19)23)27-11-10-26)16-9-5-8-15(12-16)14-6-3-2-4-7-14/h2-9,12,26H,10-11H2,(H2,23,25) |
| InChIKey | ASHKSBRCZGBUOV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|