C9H8N4O2 — CID 175961135
2-amino-6-(2-hydroxyethoxy)pyridine-3,5-dicarbonitrile (PubChem CID 175961135) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-amino-6-(2-hydroxyethoxy)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2-hydroxyethoxy)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 175961135 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-amino-6-(2-hydroxyethoxy)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(OCCO)nc1N |
| InChI | InChI=1S/C9H8N4O2/c10-4-6-3-7(5-11)9(13-8(6)12)15-2-1-14/h3,14H,1-2H2,(H2,12,13) |
| InChIKey | KRWXWYAETKIJCT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |