C12H13N3O2 — CID 156801503
4-amino-5-[2-(2-hydroxyethoxy)ethyl]benzene-1,2-dicarbonitrile (PubChem CID 156801503) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-amino-5-[2-(2-hydroxyethoxy)ethyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-amino-5-[2-(2-hydroxyethoxy)ethyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 156801503 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-amino-5-[2-(2-hydroxyethoxy)ethyl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(N)c(CCOCCO)cc1C#N |
| InChI | InChI=1S/C12H13N3O2/c13-7-10-5-9(1-3-17-4-2-16)12(15)6-11(10)8-14/h5-6,16H,1-4,15H2 |
| InChIKey | OIKFHVPHJYLIJI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|