C11H14N2 — CID 91354331
2-amino-4,5-diethylbenzonitrile (PubChem CID 91354331) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-amino-4,5-diethylbenzonitrile.
| Compound Name | 2-amino-4,5-diethylbenzonitrile |
|---|---|
| PubChem CID | 91354331 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-amino-4,5-diethylbenzonitrile |
| SMILES | CCc1cc(N)c(C#N)cc1CC |
| InChI | InChI=1S/C11H14N2/c1-3-8-5-10(7-12)11(13)6-9(8)4-2/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | UAELGLZXMUZMKV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|