C11H13N — CID 18728392
2-ethyl-4,5-dimethylbenzonitrile (PubChem CID 18728392) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethylbenzonitrile.
| Compound Name | 2-ethyl-4,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 18728392 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-ethyl-4,5-dimethylbenzonitrile |
| SMILES | CCc1cc(C)c(C)cc1C#N |
| InChI | InChI=1S/C11H13N/c1-4-10-5-8(2)9(3)6-11(10)7-12/h5-6H,4H2,1-3H3 |
| InChIKey | DIYUIGZPOVDFSF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |