C10H11NO — CID 131610761
2-(hydroxymethyl)-4,5-dimethylbenzonitrile (PubChem CID 131610761) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4,5-dimethylbenzonitrile.
| Compound Name | 2-(hydroxymethyl)-4,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 131610761 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(hydroxymethyl)-4,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)c(CO)cc1C |
| InChI | InChI=1S/C10H11NO/c1-7-3-9(5-11)10(6-12)4-8(7)2/h3-4,12H,6H2,1-2H3 |
| InChIKey | WBUJBHCOCBNCGF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |