C10H14N4O2 — CID 103468258
3-amino-6-[2-(2-hydroxyethoxy)ethylamino]pyridine-2-carbonitrile (PubChem CID 103468258) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-amino-6-[2-(2-hydroxyethoxy)ethylamino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[2-(2-hydroxyethoxy)ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468258 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-amino-6-[2-(2-hydroxyethoxy)ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NCCOCCO)ccc1N |
| InChI | InChI=1S/C10H14N4O2/c11-7-9-8(12)1-2-10(14-9)13-3-5-16-6-4-15/h1-2,15H,3-6,12H2,(H,13,14) |
| InChIKey | RMVBIFVQAKXMMA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|