C11H14N4 — CID 103469092
3-amino-6-[[(E)-pent-3-enyl]amino]pyridine-2-carbonitrile (PubChem CID 103469092) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-amino-6-[[(E)-pent-3-enyl]amino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[[(E)-pent-3-enyl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103469092 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-amino-6-[[(E)-pent-3-enyl]amino]pyridine-2-carbonitrile |
| SMILES | C/C=C/CCNc1ccc(N)c(C#N)n1 |
| InChI | InChI=1S/C11H14N4/c1-2-3-4-7-14-11-6-5-9(13)10(8-12)15-11/h2-3,5-6H,4,7,13H2,1H3,(H,14,15)/b3-2+ |
| InChIKey | OXGCLMJCRCHPPD-NSCUHMNNSA-N |
| XLogP | 1.91 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|