C8H10N4O — CID 103467344
3-amino-6-(2-hydroxyethylamino)pyridine-2-carbonitrile (PubChem CID 103467344) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-amino-6-(2-hydroxyethylamino)pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-(2-hydroxyethylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103467344 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 3-amino-6-(2-hydroxyethylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NCCO)ccc1N |
| InChI | InChI=1S/C8H10N4O/c9-5-7-6(10)1-2-8(12-7)11-3-4-13/h1-2,13H,3-4,10H2,(H,11,12) |
| InChIKey | CHNPIPDEAJCFSW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |