C11H13N7 — CID 103468558
3-amino-6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-2-carbonitrile (PubChem CID 103468558) has the molecular formula C11H13N7 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-amino-6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103468558 |
| Molecular Formula | C11H13N7 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-amino-6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NCCCc2ncn[nH]2)ccc1N |
| InChI | InChI=1S/C11H13N7/c12-6-9-8(13)3-4-10(17-9)14-5-1-2-11-15-7-16-18-11/h3-4,7H,1-2,5,13H2,(H,14,17)(H,15,16,18) |
| InChIKey | GUUWYITWKQHFNJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|