C14H21N5 — CID 107874725
5-tert-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridin-2-amine (PubChem CID 107874725) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridin-2-amine.
| Compound Name | 5-tert-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 107874725 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 5-tert-butyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(NCCCc2ncn[nH]2)nc1 |
| InChI | InChI=1S/C14H21N5/c1-14(2,3)11-6-7-12(16-9-11)15-8-4-5-13-17-10-18-19-13/h6-7,9-10H,4-5,8H2,1-3H3,(H,15,16)(H,17,18,19) |
| InChIKey | IMWYFDCNSIRCEL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|