C11H14N6O2 — CID 66455940
methyl 6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyrazine-2-carboxylate (PubChem CID 66455940) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is methyl 6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66455940 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 6-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C11H14N6O2/c1-19-11(18)8-5-12-6-10(16-8)13-4-2-3-9-14-7-15-17-9/h5-7H,2-4H2,1H3,(H,13,16)(H,14,15,17) |
| InChIKey | NFVCMTABFBUVHB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|