C12H15N5O2 — CID 113247403
methyl 6-(3-pyrazol-1-ylpropylamino)pyrazine-2-carboxylate (PubChem CID 113247403) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is methyl 6-(3-pyrazol-1-ylpropylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(3-pyrazol-1-ylpropylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 113247403 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl 6-(3-pyrazol-1-ylpropylamino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCCn2cccn2)n1 |
| InChI | InChI=1S/C12H15N5O2/c1-19-12(18)10-8-13-9-11(16-10)14-4-2-6-17-7-3-5-15-17/h3,5,7-9H,2,4,6H2,1H3,(H,14,16) |
| InChIKey | VJPZEMQLFOTAHG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|