C14H14ClN3O2 — CID 66458088
methyl 6-[2-(4-chlorophenyl)ethylamino]pyrazine-2-carboxylate (PubChem CID 66458088) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is methyl 6-[2-(4-chlorophenyl)ethylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[2-(4-chlorophenyl)ethylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66458088 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl 6-[2-(4-chlorophenyl)ethylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-20-14(19)12-8-16-9-13(18-12)17-7-6-10-2-4-11(15)5-3-10/h2-5,8-9H,6-7H2,1H3,(H,17,18) |
| InChIKey | OVVHGIDIRIUOIR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |