C14H14FN3O2 — CID 66457279
methyl 6-[2-(2-fluorophenyl)ethylamino]pyrazine-2-carboxylate (PubChem CID 66457279) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is methyl 6-[2-(2-fluorophenyl)ethylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[2-(2-fluorophenyl)ethylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457279 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | methyl 6-[2-(2-fluorophenyl)ethylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCc2ccccc2F)n1 |
| InChI | InChI=1S/C14H14FN3O2/c1-20-14(19)12-8-16-9-13(18-12)17-7-6-10-4-2-3-5-11(10)15/h2-5,8-9H,6-7H2,1H3,(H,17,18) |
| InChIKey | OVOACLPVTMRVJZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |