C14H16FN3 — CID 114475197
N-[2-(2-fluorophenyl)ethyl]-5,6-dimethylpyrazin-2-amine (PubChem CID 114475197) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5,6-dimethylpyrazin-2-amine.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 114475197 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5,6-dimethylpyrazin-2-amine |
| SMILES | Cc1ncc(NCCc2ccccc2F)nc1C |
| InChI | InChI=1S/C14H16FN3/c1-10-11(2)18-14(9-17-10)16-8-7-12-5-3-4-6-13(12)15/h3-6,9H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | JCONNMKRVYHWOP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |