C9H14N4O4S — CID 114175311
methyl 6-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carboxylate (PubChem CID 114175311) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 6-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 114175311 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | methyl 6-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carboxylate |
| SMILES | CNS(=O)(=O)CCNc1cncc(C(=O)OC)n1 |
| InChI | InChI=1S/C9H14N4O4S/c1-10-18(15,16)4-3-12-8-6-11-5-7(13-8)9(14)17-2/h5-6,10H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | RVOJECAUGYTQPI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |