C10H12F3N3O3 — CID 66458107
methyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazine-2-carboxylate (PubChem CID 66458107) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is methyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66458107 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | methyl 6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N3O3/c1-18-9(17)7-4-14-5-8(16-7)15-2-3-19-6-10(11,12)13/h4-5H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | NRPIMBZXQPNBCU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|