C13H14N4O2 — CID 66456102
methyl 6-(2-pyridin-3-ylethylamino)pyrazine-2-carboxylate (PubChem CID 66456102) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is methyl 6-(2-pyridin-3-ylethylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(2-pyridin-3-ylethylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66456102 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | methyl 6-(2-pyridin-3-ylethylamino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCc2cccnc2)n1 |
| InChI | InChI=1S/C13H14N4O2/c1-19-13(18)11-8-15-9-12(17-11)16-6-4-10-3-2-5-14-7-10/h2-3,5,7-9H,4,6H2,1H3,(H,16,17) |
| InChIKey | LAYGHNBZZLZKKJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |